C14H20N2O3 — CID 7688277
2-(2-acetamidophenoxy)-N,N-diethylacetamide (PubChem CID 7688277) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(2-acetamidophenoxy)-N,N-diethylacetamide.
| Compound Name | 2-(2-acetamidophenoxy)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 7688277 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(2-acetamidophenoxy)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccccc1NC(C)=O |
| InChI | InChI=1S/C14H20N2O3/c1-4-16(5-2)14(18)10-19-13-9-7-6-8-12(13)15-11(3)17/h6-9H,4-5,10H2,1-3H3,(H,15,17) |
| InChIKey | KOQVDQOXYUHGLC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |