C13H17FN2O2S — CID 107665931
2-(4-carbamothioyl-2-fluorophenoxy)-N,N-diethylacetamide (PubChem CID 107665931) has the molecular formula C13H17FN2O2S and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(4-carbamothioyl-2-fluorophenoxy)-N,N-diethylacetamide.
| Compound Name | 2-(4-carbamothioyl-2-fluorophenoxy)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 107665931 |
| Molecular Formula | C13H17FN2O2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(4-carbamothioyl-2-fluorophenoxy)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(C(N)=S)cc1F |
| InChI | InChI=1S/C13H17FN2O2S/c1-3-16(4-2)12(17)8-18-11-6-5-9(13(15)19)7-10(11)14/h5-7H,3-4,8H2,1-2H3,(H2,15,19) |
| InChIKey | OLBYFKNHYFCBQN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|