C13H19ClN2O2 — CID 43141794
2-[2-(aminomethyl)-4-chlorophenoxy]-N,N-diethylacetamide (PubChem CID 43141794) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-chlorophenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[2-(aminomethyl)-4-chlorophenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 43141794 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[2-(aminomethyl)-4-chlorophenoxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(Cl)cc1CN |
| InChI | InChI=1S/C13H19ClN2O2/c1-3-16(4-2)13(17)9-18-12-6-5-11(14)7-10(12)8-15/h5-7H,3-4,8-9,15H2,1-2H3 |
| InChIKey | ILISTPLGWLIAHF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |