C17H21NO3 — CID 43505758
N,N-diethyl-2-[1-(hydroxymethyl)naphthalen-2-yl]oxyacetamide (PubChem CID 43505758) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is N,N-diethyl-2-[1-(hydroxymethyl)naphthalen-2-yl]oxyacetamide.
| Compound Name | N,N-diethyl-2-[1-(hydroxymethyl)naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 43505758 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N,N-diethyl-2-[1-(hydroxymethyl)naphthalen-2-yl]oxyacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc2ccccc2c1CO |
| InChI | InChI=1S/C17H21NO3/c1-3-18(4-2)17(20)12-21-16-10-9-13-7-5-6-8-14(13)15(16)11-19/h5-10,19H,3-4,11-12H2,1-2H3 |
| InChIKey | DDYHNLGRMPEWFY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |