C25H24N2O3 — CID 7993362
N,N-dibenzyl-2-(4-cyano-2-ethoxyphenoxy)acetamide (PubChem CID 7993362) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N,N-dibenzyl-2-(4-cyano-2-ethoxyphenoxy)acetamide.
| Compound Name | N,N-dibenzyl-2-(4-cyano-2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7993362 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N,N-dibenzyl-2-(4-cyano-2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H24N2O3/c1-2-29-24-15-22(16-26)13-14-23(24)30-19-25(28)27(17-20-9-5-3-6-10-20)18-21-11-7-4-8-12-21/h3-15H,2,17-19H2,1H3 |
| InChIKey | GLGKVPPUXAMEIX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |