C25H25N3O5S — CID 27287293
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(4-cyano-2-ethoxyphenoxy)acetamide (PubChem CID 27287293) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(4-cyano-2-ethoxyphenoxy)acetamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(4-cyano-2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 27287293 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(4-cyano-2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)Nc1ccc(S(=O)(=O)N(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O5S/c1-3-32-24-15-20(16-26)9-14-23(24)33-18-25(29)27-21-10-12-22(13-11-21)34(30,31)28(2)17-19-7-5-4-6-8-19/h4-15H,3,17-18H2,1-2H3,(H,27,29) |
| InChIKey | PDZDZWNRIUZGHN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |