C20H20F2N2O4 — CID 39428702
2-(4-cyano-2-ethoxyphenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide (PubChem CID 39428702) has the molecular formula C20H20F2N2O4 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-(4-cyano-2-ethoxyphenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide.
| Compound Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 39428702 |
| Molecular Formula | C20H20F2N2O4 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H20F2N2O4/c1-3-26-18-10-15(11-23)6-9-17(18)27-13-19(25)24(2)12-14-4-7-16(8-5-14)28-20(21)22/h4-10,20H,3,12-13H2,1-2H3 |
| InChIKey | OYPGBNBQKNTGJW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |