C17H15ClF3NO3 — CID 55313801
2-(2-chloro-4-fluorophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide (PubChem CID 55313801) has the molecular formula C17H15ClF3NO3 and a molecular weight of 373.76 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 55313801 |
| Molecular Formula | C17H15ClF3NO3 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)COc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H15ClF3NO3/c1-22(9-11-2-5-13(6-3-11)25-17(20)21)16(23)10-24-15-7-4-12(19)8-14(15)18/h2-8,17H,9-10H2,1H3 |
| InChIKey | XQLVKNIBLPPEAB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |