C18H15BrF3NO4 — CID 55393532
[2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate (PubChem CID 55393532) has the molecular formula C18H15BrF3NO4 and a molecular weight of 446.22 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate.
| Compound Name | [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 55393532 |
| Molecular Formula | C18H15BrF3NO4 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)COC(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C18H15BrF3NO4/c1-23(9-11-2-5-13(6-3-11)27-18(21)22)16(24)10-26-17(25)14-7-4-12(20)8-15(14)19/h2-8,18H,9-10H2,1H3 |
| InChIKey | OFPVDZZKLOJBAJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |