About [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate
[4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate (PubChem CID 55973507) has the molecular formula C15H10BrF3O3
and a molecular weight of 375.14 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate.
Molecular Properties
| Compound Name | [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate |
| PubChem CID | 55973507 |
| Molecular Formula | C15H10BrF3O3 |
| Molecular Weight | 375.14 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate |
| SMILES | O=C(OCc1ccc(OC(F)F)cc1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C15H10BrF3O3/c16-13-6-3-10(17)7-12(13)14(20)21-8-9-1-4-11(5-2-9)22-15(18)19/h1-7,15H,8H2 |
| InChIKey | HBWACGASEMSRGN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.14 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate?
The IUPAC name of [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate (CID 55973507) is [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate.
What is the SMILES notation for [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate?
The canonical SMILES for [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate is O=C(OCc1ccc(OC(F)F)cc1)c1cc(F)ccc1Br.
What is the InChIKey of [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate?
The InChIKey is HBWACGASEMSRGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrF3O3/c16-13-6-3-10(17)7-12(13)14(20)21-8-9-1-4-11(5-2-9)22-15(18)19/h1-7,15H,8H2.
What are the key properties of [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate?
[4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate has a molecular weight of 375.14 g/mol, XLogP of 4.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(difluoromethoxy)phenyl]methyl 2-bromo-5-fluorobenzoate is sourced from PubChem (CID 55973507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).