About (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate
(3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate (PubChem CID 55404850) has the molecular formula C14H9BrF2O2
and a molecular weight of 327.12 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate.
Molecular Properties
| Compound Name | (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate |
| PubChem CID | 55404850 |
| Molecular Formula | C14H9BrF2O2 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate |
| SMILES | O=C(OCc1cccc(F)c1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C14H9BrF2O2/c15-13-5-4-11(17)7-12(13)14(18)19-8-9-2-1-3-10(16)6-9/h1-7H,8H2 |
| InChIKey | ODLKRZRTUPTRBL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate?
The IUPAC name of (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate (CID 55404850) is (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate.
What is the SMILES notation for (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate?
The canonical SMILES for (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate is O=C(OCc1cccc(F)c1)c1cc(F)ccc1Br.
What is the InChIKey of (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate?
The InChIKey is ODLKRZRTUPTRBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrF2O2/c15-13-5-4-11(17)7-12(13)14(18)19-8-9-2-1-3-10(16)6-9/h1-7H,8H2.
What are the key properties of (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate?
(3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate has a molecular weight of 327.12 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl)methyl 2-bromo-5-fluorobenzoate is sourced from PubChem (CID 55404850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).