About 2-hydroxyethyl 2-bromo-5-fluorobenzoate
2-hydroxyethyl 2-bromo-5-fluorobenzoate (PubChem CID 55537059) has the molecular formula C9H8BrFO3
and a molecular weight of 263.06 g/mol. Its IUPAC name is 2-hydroxyethyl 2-bromo-5-fluorobenzoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-bromo-5-fluorobenzoate |
| PubChem CID | 55537059 |
| Molecular Formula | C9H8BrFO3 |
| Molecular Weight | 263.06 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 2-hydroxyethyl 2-bromo-5-fluorobenzoate |
| SMILES | O=C(OCCO)c1cc(F)ccc1Br |
| InChI | InChI=1S/C9H8BrFO3/c10-8-2-1-6(11)5-7(8)9(13)14-4-3-12/h1-2,5,12H,3-4H2 |
| InChIKey | ARCDXYMUMNYOFX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.06 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyethyl 2-bromo-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-bromo-5-fluorobenzoate?
The IUPAC name of 2-hydroxyethyl 2-bromo-5-fluorobenzoate (CID 55537059) is 2-hydroxyethyl 2-bromo-5-fluorobenzoate.
What is the SMILES notation for 2-hydroxyethyl 2-bromo-5-fluorobenzoate?
The canonical SMILES for 2-hydroxyethyl 2-bromo-5-fluorobenzoate is O=C(OCCO)c1cc(F)ccc1Br.
What is the InChIKey of 2-hydroxyethyl 2-bromo-5-fluorobenzoate?
The InChIKey is ARCDXYMUMNYOFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrFO3/c10-8-2-1-6(11)5-7(8)9(13)14-4-3-12/h1-2,5,12H,3-4H2.
What are the key properties of 2-hydroxyethyl 2-bromo-5-fluorobenzoate?
2-hydroxyethyl 2-bromo-5-fluorobenzoate has a molecular weight of 263.06 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-bromo-5-fluorobenzoate is sourced from PubChem (CID 55537059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).