C13H14BrFN2O4 — CID 8987555
[2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate (PubChem CID 8987555) has the molecular formula C13H14BrFN2O4 and a molecular weight of 361.17 g/mol. Its IUPAC name is [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate.
| Compound Name | [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate |
|---|---|
| PubChem CID | 8987555 |
| Molecular Formula | C13H14BrFN2O4 |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate |
| SMILES | CN(C)C(=O)CNC(=O)COC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C13H14BrFN2O4/c1-17(2)12(19)6-16-11(18)7-21-13(20)9-5-8(15)3-4-10(9)14/h3-5H,6-7H2,1-2H3,(H,16,18) |
| InChIKey | UAEBSKPZHWQPNO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |