C12H13BrFNO3 — CID 8987106
[2-oxo-2-(propan-2-ylamino)ethyl] 2-bromo-5-fluorobenzoate (PubChem CID 8987106) has the molecular formula C12H13BrFNO3 and a molecular weight of 318.14 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] 2-bromo-5-fluorobenzoate.
| Compound Name | [2-oxo-2-(propan-2-ylamino)ethyl] 2-bromo-5-fluorobenzoate |
|---|---|
| PubChem CID | 8987106 |
| Molecular Formula | C12H13BrFNO3 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | [2-oxo-2-(propan-2-ylamino)ethyl] 2-bromo-5-fluorobenzoate |
| SMILES | CC(C)NC(=O)COC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C12H13BrFNO3/c1-7(2)15-11(16)6-18-12(17)9-5-8(14)3-4-10(9)13/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | YJBJTEDHCRWODB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |