C18H17BrFNO3 — CID 8987534
[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 2-bromo-5-fluorobenzoate (PubChem CID 8987534) has the molecular formula C18H17BrFNO3 and a molecular weight of 394.24 g/mol. Its IUPAC name is [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 2-bromo-5-fluorobenzoate.
| Compound Name | [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 2-bromo-5-fluorobenzoate |
|---|---|
| PubChem CID | 8987534 |
| Molecular Formula | C18H17BrFNO3 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 2-bromo-5-fluorobenzoate |
| SMILES | Cc1ccccc1CCNC(=O)COC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C18H17BrFNO3/c1-12-4-2-3-5-13(12)8-9-21-17(22)11-24-18(23)15-10-14(20)6-7-16(15)19/h2-7,10H,8-9,11H2,1H3,(H,21,22) |
| InChIKey | RQVHGDOEVAGBPA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |