C15H13BrFNO4 — CID 55404838
[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate (PubChem CID 55404838) has the molecular formula C15H13BrFNO4 and a molecular weight of 370.17 g/mol. Its IUPAC name is [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate.
| Compound Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate |
|---|---|
| PubChem CID | 55404838 |
| Molecular Formula | C15H13BrFNO4 |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate |
| SMILES | CN(Cc1ccco1)C(=O)COC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C15H13BrFNO4/c1-18(8-11-3-2-6-21-11)14(19)9-22-15(20)12-7-10(17)4-5-13(12)16/h2-7H,8-9H2,1H3 |
| InChIKey | QKXRNICEDAJXEK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |