C17H18N2O8 — CID 7583235
[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 7583235) has the molecular formula C17H18N2O8 and a molecular weight of 378.34 g/mol. Its IUPAC name is [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 7583235 |
| Molecular Formula | C17H18N2O8 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)N(C)Cc2ccco2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H18N2O8/c1-18(9-11-5-4-6-26-11)16(20)10-27-17(21)12-7-14(24-2)15(25-3)8-13(12)19(22)23/h4-8H,9-10H2,1-3H3 |
| InChIKey | JJLKWENGDRPUHX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 121.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|