C20H20N2O6S — CID 90495710
N-(furan-2-ylmethyl)-4,5-dimethoxy-2-nitro-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 90495710) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4,5-dimethoxy-2-nitro-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4,5-dimethoxy-2-nitro-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 90495710 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-4,5-dimethoxy-2-nitro-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | COc1cc(C(=O)N(CCc2cccs2)Cc2ccco2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H20N2O6S/c1-26-18-11-16(17(22(24)25)12-19(18)27-2)20(23)21(13-14-5-3-9-28-14)8-7-15-6-4-10-29-15/h3-6,9-12H,7-8,13H2,1-2H3 |
| InChIKey | SKLQNKIZBQUQMX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 95.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|