C16H18N2O6S — CID 42983952
[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate (PubChem CID 42983952) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate.
| Compound Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42983952 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)N(C)Cc1ccco1 |
| InChI | InChI=1S/C16H18N2O6S/c1-11-5-6-13(25(17,21)22)8-14(11)16(20)24-10-15(19)18(2)9-12-4-3-7-23-12/h3-8H,9-10H2,1-2H3,(H2,17,21,22) |
| InChIKey | OYMDJEHGDHCNRL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |