C18H16FNO8 — CID 7235698
[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 7235698) has the molecular formula C18H16FNO8 and a molecular weight of 393.32 g/mol. Its IUPAC name is [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 7235698 |
| Molecular Formula | C18H16FNO8 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2cc(F)ccc2OC)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H16FNO8/c1-25-15-5-4-10(19)6-12(15)14(21)9-28-18(22)11-7-16(26-2)17(27-3)8-13(11)20(23)24/h4-8H,9H2,1-3H3 |
| InChIKey | IMTGSFLZIRABRH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|