C19H21N3O7 — CID 7781650
[2-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 7781650) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is [2-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 7781650 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [2-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | COc1ccc(CN(C)C(=O)COC(=O)c2ccc(N)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C19H21N3O7/c1-21(10-12-4-7-16(27-2)17(8-12)28-3)18(23)11-29-19(24)13-5-6-14(20)15(9-13)22(25)26/h4-9H,10-11,20H2,1-3H3 |
| InChIKey | MKZBAWBUEULWIE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|