C19H19FN2O6 — CID 18193667
[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate (PubChem CID 18193667) has the molecular formula C19H19FN2O6 and a molecular weight of 390.37 g/mol. Its IUPAC name is [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 18193667 |
| Molecular Formula | C19H19FN2O6 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate |
| SMILES | COc1ccc(CN(C)C(=O)COC(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1F |
| InChI | InChI=1S/C19H19FN2O6/c1-12-4-6-14(9-16(12)22(25)26)19(24)28-11-18(23)21(2)10-13-5-7-17(27-3)15(20)8-13/h4-9H,10-11H2,1-3H3 |
| InChIKey | FPZISZVCDHXXFQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|