C21H20FN3O4 — CID 18193762
[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate (PubChem CID 18193762) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate.
| Compound Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate |
|---|---|
| PubChem CID | 18193762 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate |
| SMILES | COc1ccc(CN(C)C(=O)COC(=O)c2ccc(-n3cccn3)cc2)cc1F |
| InChI | InChI=1S/C21H20FN3O4/c1-24(13-15-4-9-19(28-2)18(22)12-15)20(26)14-29-21(27)16-5-7-17(8-6-16)25-11-3-10-23-25/h3-12H,13-14H2,1-2H3 |
| InChIKey | WNKVWRHBVQKKRO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |