C21H20FN3O3 — CID 18158295
[2-[(4-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-(pyrazol-1-ylmethyl)benzoate (PubChem CID 18158295) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-(pyrazol-1-ylmethyl)benzoate.
| Compound Name | [2-[(4-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-(pyrazol-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 18158295 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [2-[(4-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-(pyrazol-1-ylmethyl)benzoate |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)COC(=O)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C21H20FN3O3/c1-24(13-16-5-9-19(22)10-6-16)20(26)15-28-21(27)18-7-3-17(4-8-18)14-25-12-2-11-23-25/h2-12H,13-15H2,1H3 |
| InChIKey | KURDWYNZQFENIR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |