C21H24FNO6 — CID 55373143
[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (PubChem CID 55373143) has the molecular formula C21H24FNO6 and a molecular weight of 405.42 g/mol. Its IUPAC name is [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.
| Compound Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 55373143 |
| Molecular Formula | C21H24FNO6 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N(C)Cc2ccc(OC)c(F)c2)cc1OC |
| InChI | InChI=1S/C21H24FNO6/c1-5-28-18-9-7-15(11-19(18)27-4)21(25)29-13-20(24)23(2)12-14-6-8-17(26-3)16(22)10-14/h6-11H,5,12-13H2,1-4H3 |
| InChIKey | VQZKACBXSWZAGU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |