C22H27NO6 — CID 7558699
[2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate (PubChem CID 7558699) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate.
| Compound Name | [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 7558699 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1ccc(CN(C)C(=O)COC(=O)c2ccc(OC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C22H27NO6/c1-5-27-18-10-7-16(8-11-18)14-23(3)21(24)15-29-22(25)17-9-12-19(26-4)20(13-17)28-6-2/h7-13H,5-6,14-15H2,1-4H3 |
| InChIKey | KIKGZGHDLRTAHX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |