About [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate (PubChem CID 55404716) has the molecular formula C19H19BrFNO3
and a molecular weight of 408.27 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate.
Molecular Properties
| Compound Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate |
| PubChem CID | 55404716 |
| Molecular Formula | C19H19BrFNO3 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)COC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C19H19BrFNO3/c1-13(2)22(11-14-6-4-3-5-7-14)18(23)12-25-19(24)16-10-15(21)8-9-17(16)20/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | AHTWCEFARXMYKH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate?
The IUPAC name of [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate (CID 55404716) is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate.
What is the SMILES notation for [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate?
The canonical SMILES for [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate is CC(C)N(Cc1ccccc1)C(=O)COC(=O)c1cc(F)ccc1Br.
What is the InChIKey of [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate?
The InChIKey is AHTWCEFARXMYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrFNO3/c1-13(2)22(11-14-6-4-3-5-7-14)18(23)12-25-19(24)16-10-15(21)8-9-17(16)20/h3-10,13H,11-12H2,1-2H3.
What are the key properties of [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate?
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate has a molecular weight of 408.27 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-bromo-5-fluorobenzoate is sourced from PubChem (CID 55404716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).