C25H25NO4 — CID 2511443
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-phenoxybenzoate (PubChem CID 2511443) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-phenoxybenzoate.
| Compound Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-phenoxybenzoate |
|---|---|
| PubChem CID | 2511443 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-phenoxybenzoate |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)COC(=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H25NO4/c1-19(2)26(17-20-10-5-3-6-11-20)24(27)18-29-25(28)21-12-9-15-23(16-21)30-22-13-7-4-8-14-22/h3-16,19H,17-18H2,1-2H3 |
| InChIKey | CKFOUGPSXMIGLN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |