C24H24N2O4S — CID 30818019
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate (PubChem CID 30818019) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 30818019 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)COC(=O)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C24H24N2O4S/c1-17(2)26(15-18-8-4-3-5-9-18)22(27)16-30-24(29)19-10-6-11-20(14-19)25-23(28)21-12-7-13-31-21/h3-14,17H,15-16H2,1-2H3,(H,25,28) |
| InChIKey | HAQQERKKLHHPDV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |