C22H17N3O4S — CID 30819107
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate (PubChem CID 30819107) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 30819107 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
| SMILES | N#CCN(C(=O)COC(=O)c1cccc(NC(=O)c2cccs2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O4S/c23-11-12-25(18-8-2-1-3-9-18)20(26)15-29-22(28)16-6-4-7-17(14-16)24-21(27)19-10-5-13-30-19/h1-10,13-14H,12,15H2,(H,24,27) |
| InChIKey | GGUDNGAFUXGGKK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|