C19H14FNO3S — CID 7888664
(2-fluorophenyl)methyl 3-(thiophene-2-carbonylamino)benzoate (PubChem CID 7888664) has the molecular formula C19H14FNO3S and a molecular weight of 355.39 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 3-(thiophene-2-carbonylamino)benzoate.
| Compound Name | (2-fluorophenyl)methyl 3-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 7888664 |
| Molecular Formula | C19H14FNO3S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (2-fluorophenyl)methyl 3-(thiophene-2-carbonylamino)benzoate |
| SMILES | O=C(OCc1ccccc1F)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H14FNO3S/c20-16-8-2-1-5-14(16)12-24-19(23)13-6-3-7-15(11-13)21-18(22)17-9-4-10-25-17/h1-11H,12H2,(H,21,22) |
| InChIKey | MDQAJBBHKJXNIP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |