C21H17FN2O4S — CID 7888732
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate (PubChem CID 7888732) has the molecular formula C21H17FN2O4S and a molecular weight of 412.44 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 7888732 |
| Molecular Formula | C21H17FN2O4S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
| SMILES | O=C(COC(=O)c1cccc(NC(=O)c2cccs2)c1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2O4S/c22-16-8-6-14(7-9-16)12-23-19(25)13-28-21(27)15-3-1-4-17(11-15)24-20(26)18-5-2-10-29-18/h1-11H,12-13H2,(H,23,25)(H,24,26) |
| InChIKey | XCMLDNFOCSULBK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |