C18H20N2O5S — CID 27044974
[2-[[(2S)-1-methoxypropan-2-yl]amino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate (PubChem CID 27044974) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is [2-[[(2S)-1-methoxypropan-2-yl]amino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-[[(2S)-1-methoxypropan-2-yl]amino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 27044974 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [2-[[(2S)-1-methoxypropan-2-yl]amino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
| SMILES | COC[C@H](C)NC(=O)COC(=O)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-12(10-24-2)19-16(21)11-25-18(23)13-5-3-6-14(9-13)20-17(22)15-7-4-8-26-15/h3-9,12H,10-11H2,1-2H3,(H,19,21)(H,20,22)/t12-/m0/s1 |
| InChIKey | DPBUTEASJWLSEX-LBPRGKRZSA-N |
| XLogP | 2.31 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |