C20H15ClN2O4S — CID 7491904
[2-(3-chloroanilino)-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate (PubChem CID 7491904) has the molecular formula C20H15ClN2O4S and a molecular weight of 414.87 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 7491904 |
| Molecular Formula | C20H15ClN2O4S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 3-(thiophene-2-carbonylamino)benzoate |
| SMILES | O=C(COC(=O)c1cccc(NC(=O)c2cccs2)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H15ClN2O4S/c21-14-5-2-7-16(11-14)22-18(24)12-27-20(26)13-4-1-6-15(10-13)23-19(25)17-8-3-9-28-17/h1-11H,12H2,(H,22,24)(H,23,25) |
| InChIKey | SXHYVPPXPWPAEU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |