C22H21NO5S — CID 7492050
2-(4-ethoxyphenoxy)ethyl 3-(thiophene-2-carbonylamino)benzoate (PubChem CID 7492050) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl 3-(thiophene-2-carbonylamino)benzoate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl 3-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 7492050 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl 3-(thiophene-2-carbonylamino)benzoate |
| SMILES | CCOc1ccc(OCCOC(=O)c2cccc(NC(=O)c3cccs3)c2)cc1 |
| InChI | InChI=1S/C22H21NO5S/c1-2-26-18-8-10-19(11-9-18)27-12-13-28-22(25)16-5-3-6-17(15-16)23-21(24)20-7-4-14-29-20/h3-11,14-15H,2,12-13H2,1H3,(H,23,24) |
| InChIKey | UMCBJPGSMORQTP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|