C20H23BrN2O5S — CID 2498205
[2-[benzyl(methyl)amino]-2-oxoethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate (PubChem CID 2498205) has the molecular formula C20H23BrN2O5S and a molecular weight of 483.38 g/mol. Its IUPAC name is [2-[benzyl(methyl)amino]-2-oxoethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | [2-[benzyl(methyl)amino]-2-oxoethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2498205 |
| Molecular Formula | C20H23BrN2O5S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | [2-[benzyl(methyl)amino]-2-oxoethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(Br)c(C(=O)OCC(=O)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H23BrN2O5S/c1-14(2)22-29(26,27)16-9-10-18(21)17(11-16)20(25)28-13-19(24)23(3)12-15-7-5-4-6-8-15/h4-11,14,22H,12-13H2,1-3H3 |
| InChIKey | FOBHEVDWTCJJOR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |