C16H23BrN2O5S — CID 2498065
[2-(tert-butylamino)-2-oxoethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate (PubChem CID 2498065) has the molecular formula C16H23BrN2O5S and a molecular weight of 435.34 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2498065 |
| Molecular Formula | C16H23BrN2O5S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(Br)c(C(=O)OCC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C16H23BrN2O5S/c1-10(2)19-25(22,23)11-6-7-13(17)12(8-11)15(21)24-9-14(20)18-16(3,4)5/h6-8,10,19H,9H2,1-5H3,(H,18,20) |
| InChIKey | QTGQSDYJABALNR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |