C16H20BrN3O6S — CID 2676679
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate (PubChem CID 2676679) has the molecular formula C16H20BrN3O6S and a molecular weight of 462.32 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2676679 |
| Molecular Formula | C16H20BrN3O6S |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-bromo-5-(propan-2-ylsulfamoyl)benzoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)NC(C)C)ccc1Br |
| InChI | InChI=1S/C16H20BrN3O6S/c1-4-7-18-16(23)19-14(21)9-26-15(22)12-8-11(5-6-13(12)17)27(24,25)20-10(2)3/h4-6,8,10,20H,1,7,9H2,2-3H3,(H2,18,19,21,23) |
| InChIKey | HGYJPNCBZXHPSZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|