C15H20BrN3O4S — CID 9301754
2-bromo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-5-(prop-2-enylsulfamoyl)benzamide (PubChem CID 9301754) has the molecular formula C15H20BrN3O4S and a molecular weight of 418.31 g/mol. Its IUPAC name is 2-bromo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-5-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | 2-bromo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-5-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9301754 |
| Molecular Formula | C15H20BrN3O4S |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2-bromo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-5-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(Br)c(C(=O)NCC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C15H20BrN3O4S/c1-4-7-18-24(22,23)11-5-6-13(16)12(8-11)15(21)17-9-14(20)19-10(2)3/h4-6,8,10,18H,1,7,9H2,2-3H3,(H,17,21)(H,19,20) |
| InChIKey | JQXQQLZOYQMFGK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|