C10H12BrN3O4S — CID 9296499
N-(2-amino-2-oxoethyl)-2-bromo-5-(methylsulfamoyl)benzamide (PubChem CID 9296499) has the molecular formula C10H12BrN3O4S and a molecular weight of 350.19 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-bromo-5-(methylsulfamoyl)benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-bromo-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9296499 |
| Molecular Formula | C10H12BrN3O4S |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-bromo-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(Br)c(C(=O)NCC(N)=O)c1 |
| InChI | InChI=1S/C10H12BrN3O4S/c1-13-19(17,18)6-2-3-8(11)7(4-6)10(16)14-5-9(12)15/h2-4,13H,5H2,1H3,(H2,12,15)(H,14,16) |
| InChIKey | NMHLJAKOJFZHAM-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |