C16H12BrClN4O3S — CID 154873489
2-bromo-N-(7-chloro-1,8-naphthyridin-2-yl)-5-(methylsulfamoyl)benzamide (PubChem CID 154873489) has the molecular formula C16H12BrClN4O3S and a molecular weight of 455.72 g/mol. Its IUPAC name is 2-bromo-N-(7-chloro-1,8-naphthyridin-2-yl)-5-(methylsulfamoyl)benzamide.
| Compound Name | 2-bromo-N-(7-chloro-1,8-naphthyridin-2-yl)-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 154873489 |
| Molecular Formula | C16H12BrClN4O3S |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | 2-bromo-N-(7-chloro-1,8-naphthyridin-2-yl)-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(Br)c(C(=O)Nc2ccc3ccc(Cl)nc3n2)c1 |
| InChI | InChI=1S/C16H12BrClN4O3S/c1-19-26(24,25)10-4-5-12(17)11(8-10)16(23)22-14-7-3-9-2-6-13(18)20-15(9)21-14/h2-8,19H,1H3,(H,20,21,22,23) |
| InChIKey | ZQGLMVAGLCLXCI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|