C19H17F2N3O6S — CID 4846277
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-[(3,4-difluorophenyl)sulfonylamino]benzoate (PubChem CID 4846277) has the molecular formula C19H17F2N3O6S and a molecular weight of 453.42 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-[(3,4-difluorophenyl)sulfonylamino]benzoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-[(3,4-difluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4846277 |
| Molecular Formula | C19H17F2N3O6S |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-[(3,4-difluorophenyl)sulfonylamino]benzoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1cccc(NS(=O)(=O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H17F2N3O6S/c1-2-8-22-19(27)23-17(25)11-30-18(26)12-4-3-5-13(9-12)24-31(28,29)14-6-7-15(20)16(21)10-14/h2-7,9-10,24H,1,8,11H2,(H2,22,23,25,27) |
| InChIKey | LTZHGDHPKBQHRK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|