C19H12F2N2O6S — CID 42938679
(4-nitrophenyl) 3-[(3,4-difluorophenyl)sulfonylamino]benzoate (PubChem CID 42938679) has the molecular formula C19H12F2N2O6S and a molecular weight of 434.38 g/mol. Its IUPAC name is (4-nitrophenyl) 3-[(3,4-difluorophenyl)sulfonylamino]benzoate.
| Compound Name | (4-nitrophenyl) 3-[(3,4-difluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 42938679 |
| Molecular Formula | C19H12F2N2O6S |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | (4-nitrophenyl) 3-[(3,4-difluorophenyl)sulfonylamino]benzoate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1cccc(NS(=O)(=O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H12F2N2O6S/c20-17-9-8-16(11-18(17)21)30(27,28)22-13-3-1-2-12(10-13)19(24)29-15-6-4-14(5-7-15)23(25)26/h1-11,22H |
| InChIKey | HDTUIUBMNJUQDS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|