C22H17F2N3O7S — CID 2086829
[2-(4-methyl-3-nitroanilino)-2-oxoethyl] 3-[(3,4-difluorophenyl)sulfonylamino]benzoate (PubChem CID 2086829) has the molecular formula C22H17F2N3O7S and a molecular weight of 505.46 g/mol. Its IUPAC name is [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 3-[(3,4-difluorophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 3-[(3,4-difluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2086829 |
| Molecular Formula | C22H17F2N3O7S |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 3-[(3,4-difluorophenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2cccc(NS(=O)(=O)c3ccc(F)c(F)c3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17F2N3O7S/c1-13-5-6-15(10-20(13)27(30)31)25-21(28)12-34-22(29)14-3-2-4-16(9-14)26-35(32,33)17-7-8-18(23)19(24)11-17/h2-11,26H,12H2,1H3,(H,25,28) |
| InChIKey | LLKJHDWKQXLIEK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|