C18H16F2N2O5S — CID 7828428
[2-(3,4-difluoroanilino)-2-oxoethyl] 4-(prop-2-enylsulfamoyl)benzoate (PubChem CID 7828428) has the molecular formula C18H16F2N2O5S and a molecular weight of 410.40 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 4-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7828428 |
| Molecular Formula | C18H16F2N2O5S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H16F2N2O5S/c1-2-9-21-28(25,26)14-6-3-12(4-7-14)18(24)27-11-17(23)22-13-5-8-15(19)16(20)10-13/h2-8,10,21H,1,9,11H2,(H,22,23) |
| InChIKey | LNJJATUADUYGHX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|