C18H22N4O5S — CID 8641654
[2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] 4-(prop-2-enylsulfamoyl)benzoate (PubChem CID 8641654) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] 4-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] 4-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8641654 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] 4-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C18H22N4O5S/c1-5-10-19-28(25,26)15-8-6-14(7-9-15)18(24)27-11-16(23)20-17-12(2)21-22(4)13(17)3/h5-9,19H,1,10-11H2,2-4H3,(H,20,23) |
| InChIKey | XOGVBKSNYWUYQI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|