C16H14F2N2O3S — CID 109058545
4-[(3,4-difluorophenyl)sulfamoyl]-N-prop-2-enylbenzamide (PubChem CID 109058545) has the molecular formula C16H14F2N2O3S and a molecular weight of 352.36 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)sulfamoyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-[(3,4-difluorophenyl)sulfamoyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 109058545 |
| Molecular Formula | C16H14F2N2O3S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 4-[(3,4-difluorophenyl)sulfamoyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H14F2N2O3S/c1-2-9-19-16(21)11-3-6-13(7-4-11)24(22,23)20-12-5-8-14(17)15(18)10-12/h2-8,10,20H,1,9H2,(H,19,21) |
| InChIKey | FBQAAQSOPFHJPW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|