C13H13IN2O4 — CID 2628667
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-iodobenzoate (PubChem CID 2628667) has the molecular formula C13H13IN2O4 and a molecular weight of 388.16 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-iodobenzoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-iodobenzoate |
|---|---|
| PubChem CID | 2628667 |
| Molecular Formula | C13H13IN2O4 |
| Molecular Weight | 388.16 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-iodobenzoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C13H13IN2O4/c1-2-6-15-13(19)16-11(17)8-20-12(18)9-4-3-5-10(14)7-9/h2-5,7H,1,6,8H2,(H2,15,16,17,19) |
| InChIKey | GBXJRYBPFGRBDL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|