C13H15IN2O5 — CID 16522270
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 3-iodobenzoate (PubChem CID 16522270) has the molecular formula C13H15IN2O5 and a molecular weight of 406.18 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 3-iodobenzoate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 3-iodobenzoate |
|---|---|
| PubChem CID | 16522270 |
| Molecular Formula | C13H15IN2O5 |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 3-iodobenzoate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C13H15IN2O5/c1-20-6-5-15-13(19)16-11(17)8-21-12(18)9-3-2-4-10(14)7-9/h2-4,7H,5-6,8H2,1H3,(H2,15,16,17,19) |
| InChIKey | KBNFIJSRFTXHQZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|