C19H20Cl2N2O3 — CID 2620401
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 2620401) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2620401 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)COC(=O)c1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-12(2)23(10-13-6-4-3-5-7-13)17(24)11-26-19(25)15-8-14(20)9-16(21)18(15)22/h3-9,12H,10-11,22H2,1-2H3 |
| InChIKey | PWZHPTOUCHDUJJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|